C31H35N3O2 — CID 58856355
3-[(2-amino-2-methyl-3-phenylpropoxy)methyl]-N-benzyl-5-(1-isocyanocyclopentyl)benzamide (PubChem CID 58856355) has the molecular formula C31H35N3O2 and a molecular weight of 481.64 g/mol. Its IUPAC name is 3-[(2-amino-2-methyl-3-phenylpropoxy)methyl]-N-benzyl-5-(1-isocyanocyclopentyl)benzamide.
| Compound Name | 3-[(2-amino-2-methyl-3-phenylpropoxy)methyl]-N-benzyl-5-(1-isocyanocyclopentyl)benzamide |
|---|---|
| PubChem CID | 58856355 |
| Molecular Formula | C31H35N3O2 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.27 |
| IUPAC Name | 3-[(2-amino-2-methyl-3-phenylpropoxy)methyl]-N-benzyl-5-(1-isocyanocyclopentyl)benzamide |
| SMILES | [C-]#[N+]C1(c2cc(COCC(C)(N)Cc3ccccc3)cc(C(=O)NCc3ccccc3)c2)CCCC1 |
| InChI | InChI=1S/C31H35N3O2/c1-30(32,20-24-11-5-3-6-12-24)23-36-22-26-17-27(29(35)34-21-25-13-7-4-8-14-25)19-28(18-26)31(33-2)15-9-10-16-31/h3-8,11-14,17-19H,9-10,15-16,20-23,32H2,1H3,(H,34,35) |
| InChIKey | QRMBFLMLTAVYCP-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 68.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|