About 5-butan-2-yl-1,2,3-trimethylcyclohexene
5-butan-2-yl-1,2,3-trimethylcyclohexene (PubChem CID 58856701) has the molecular formula C13H24
and a molecular weight of 180.34 g/mol. Its IUPAC name is 5-butan-2-yl-1,2,3-trimethylcyclohexene.
Molecular Properties
| Compound Name | 5-butan-2-yl-1,2,3-trimethylcyclohexene |
| PubChem CID | 58856701 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.34 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | 5-butan-2-yl-1,2,3-trimethylcyclohexene |
| SMILES | CCC(C)C1CC(C)=C(C)C(C)C1 |
| InChI | InChI=1S/C13H24/c1-6-9(2)13-7-10(3)12(5)11(4)8-13/h9-10,13H,6-8H2,1-5H3 |
| InChIKey | FVMRPIIAFCEDPA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.34 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-butan-2-yl-1,2,3-trimethylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butan-2-yl-1,2,3-trimethylcyclohexene?
The IUPAC name of 5-butan-2-yl-1,2,3-trimethylcyclohexene (CID 58856701) is 5-butan-2-yl-1,2,3-trimethylcyclohexene.
What is the SMILES notation for 5-butan-2-yl-1,2,3-trimethylcyclohexene?
The canonical SMILES for 5-butan-2-yl-1,2,3-trimethylcyclohexene is CCC(C)C1CC(C)=C(C)C(C)C1.
What is the InChIKey of 5-butan-2-yl-1,2,3-trimethylcyclohexene?
The InChIKey is FVMRPIIAFCEDPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24/c1-6-9(2)13-7-10(3)12(5)11(4)8-13/h9-10,13H,6-8H2,1-5H3.
What are the key properties of 5-butan-2-yl-1,2,3-trimethylcyclohexene?
5-butan-2-yl-1,2,3-trimethylcyclohexene has a molecular weight of 180.34 g/mol, XLogP of 4.41, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butan-2-yl-1,2,3-trimethylcyclohexene is sourced from PubChem (CID 58856701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).