C33H20F6N2O7 — CID 58856750
5-[2-[4-[1,1,1,3,3,3-hexafluoro-2-(3-hydroxy-4-methylphenyl)propan-2-yl]-2-hydroxyphenyl]-1,3-dioxoisoindol-5-yl]oxy-2-methylisoindole-1,3-dione (PubChem CID 58856750) has the molecular formula C33H20F6N2O7 and a molecular weight of 670.52 g/mol. Its IUPAC name is 5-[2-[4-[1,1,1,3,3,3-hexafluoro-2-(3-hydroxy-4-methylphenyl)propan-2-yl]-2-hydroxyphenyl]-1,3-dioxoisoindol-5-yl]oxy-2-methylisoindole-1,3-dione.
| Compound Name | 5-[2-[4-[1,1,1,3,3,3-hexafluoro-2-(3-hydroxy-4-methylphenyl)propan-2-yl]-2-hydroxyphenyl]-1,3-dioxoisoindol-5-yl]oxy-2-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 58856750 |
| Molecular Formula | C33H20F6N2O7 |
| Molecular Weight | 670.52 g/mol |
| Exact Mass | 670.12 |
| IUPAC Name | 5-[2-[4-[1,1,1,3,3,3-hexafluoro-2-(3-hydroxy-4-methylphenyl)propan-2-yl]-2-hydroxyphenyl]-1,3-dioxoisoindol-5-yl]oxy-2-methylisoindole-1,3-dione |
| SMILES | Cc1ccc(C(c2ccc(N3C(=O)c4ccc(Oc5ccc6c(c5)C(=O)N(C)C6=O)cc4C3=O)c(O)c2)(C(F)(F)F)C(F)(F)F)cc1O |
| InChI | InChI=1S/C33H20F6N2O7/c1-15-3-4-16(11-25(15)42)31(32(34,35)36,33(37,38)39)17-5-10-24(26(43)12-17)41-29(46)21-9-7-19(14-23(21)30(41)47)48-18-6-8-20-22(13-18)28(45)40(2)27(20)44/h3-14,42-43H,1-2H3 |
| InChIKey | GXQMIAGIVLESGR-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.52 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|