About 2,6-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-methylphenol;zinc
2,6-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-methylphenol;zinc (PubChem CID 58856885) has the molecular formula C33H34N6OZn2
and a molecular weight of 661.46 g/mol. Its IUPAC name is 2,6-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-methylphenol;zinc.
Molecular Properties
| Compound Name | 2,6-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-methylphenol;zinc |
| PubChem CID | 58856885 |
| Molecular Formula | C33H34N6OZn2 |
| Molecular Weight | 661.46 g/mol |
| Exact Mass | 658.14 |
| IUPAC Name | 2,6-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-methylphenol;zinc |
| SMILES | Cc1cc(CN(Cc2ccccn2)Cc2ccccn2)c(O)c(CN(Cc2ccccn2)Cc2ccccn2)c1.[Zn].[Zn] |
| InChI | InChI=1S/C33H34N6O.2Zn/c1-26-18-27(20-38(22-29-10-2-6-14-34-29)23-30-11-3-7-15-35-30)33(40)28(19-26)21-39(24-31-12-4-8-16-36-31)25-32-13-5-9-17-37-32;;/h2-19,40H,20-25H2,1H3;; |
| InChIKey | USASXVBYXSIZLR-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 661.46 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,6-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-methylphenol;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-methylphenol;zinc?
The IUPAC name of 2,6-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-methylphenol;zinc (CID 58856885) is 2,6-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-methylphenol;zinc.
What is the SMILES notation for 2,6-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-methylphenol;zinc?
The canonical SMILES for 2,6-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-methylphenol;zinc is Cc1cc(CN(Cc2ccccn2)Cc2ccccn2)c(O)c(CN(Cc2ccccn2)Cc2ccccn2)c1.[Zn].[Zn].
What is the InChIKey of 2,6-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-methylphenol;zinc?
The InChIKey is USASXVBYXSIZLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H34N6O.2Zn/c1-26-18-27(20-38(22-29-10-2-6-14-34-29)23-30-11-3-7-15-35-30)33(40)28(19-26)21-39(24-31-12-4-8-16-36-31)25-32-13-5-9-17-37-32;;/h2-19,40H,20-25H2,1H3;;.
What are the key properties of 2,6-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-methylphenol;zinc?
2,6-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-methylphenol;zinc has a molecular weight of 661.46 g/mol, XLogP of 5.68, 12 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-methylphenol;zinc is sourced from PubChem (CID 58856885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).