C21H25F6NO2S — CID 58857168
3-cyclopentyl-1-[(2S)-2-ethyl-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]propan-1-one (PubChem CID 58857168) has the molecular formula C21H25F6NO2S and a molecular weight of 469.49 g/mol. Its IUPAC name is 3-cyclopentyl-1-[(2S)-2-ethyl-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]propan-1-one.
| Compound Name | 3-cyclopentyl-1-[(2S)-2-ethyl-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]propan-1-one |
|---|---|
| PubChem CID | 58857168 |
| Molecular Formula | C21H25F6NO2S |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | 3-cyclopentyl-1-[(2S)-2-ethyl-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]propan-1-one |
| SMILES | CC[C@H]1CN(C(=O)CCC2CCCC2)c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2S1 |
| InChI | InChI=1S/C21H25F6NO2S/c1-2-15-12-28(18(29)10-7-13-5-3-4-6-13)16-9-8-14(11-17(16)31-15)19(30,20(22,23)24)21(25,26)27/h8-9,11,13,15,30H,2-7,10,12H2,1H3/t15-/m0/s1 |
| InChIKey | NJYXTNCXHXCAQG-HNNXBMFYSA-N |
| XLogP | 6.19 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |