C17H17F6NO4S — CID 58857186
[2-[(2S)-2-ethyl-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]-2-oxoethyl] acetate (PubChem CID 58857186) has the molecular formula C17H17F6NO4S and a molecular weight of 445.38 g/mol. Its IUPAC name is [2-[(2S)-2-ethyl-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[(2S)-2-ethyl-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 58857186 |
| Molecular Formula | C17H17F6NO4S |
| Molecular Weight | 445.38 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | [2-[(2S)-2-ethyl-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]-2-oxoethyl] acetate |
| SMILES | CC[C@H]1CN(C(=O)COC(C)=O)c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2S1 |
| InChI | InChI=1S/C17H17F6NO4S/c1-3-11-7-24(14(26)8-28-9(2)25)12-5-4-10(6-13(12)29-11)15(27,16(18,19)20)17(21,22)23/h4-6,11,27H,3,7-8H2,1-2H3/t11-/m0/s1 |
| InChIKey | MFPYFOCZSSJAIN-NSHDSACASA-N |
| XLogP | 3.78 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |