C30H29F6NO3 — CID 58857202
(2S)-1-[(3S)-3-(2,5-dimethylphenoxy)-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-2-phenylpropan-1-one (PubChem CID 58857202) has the molecular formula C30H29F6NO3 and a molecular weight of 565.55 g/mol. Its IUPAC name is (2S)-1-[(3S)-3-(2,5-dimethylphenoxy)-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-2-phenylpropan-1-one.
| Compound Name | (2S)-1-[(3S)-3-(2,5-dimethylphenoxy)-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-2-phenylpropan-1-one |
|---|---|
| PubChem CID | 58857202 |
| Molecular Formula | C30H29F6NO3 |
| Molecular Weight | 565.55 g/mol |
| Exact Mass | 565.21 |
| IUPAC Name | (2S)-1-[(3S)-3-(2,5-dimethylphenoxy)-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-2-phenylpropan-1-one |
| SMILES | Cc1ccc(C)c(O[C@H]2CCc3cc(C(O)(C(F)(F)F)C(F)(F)F)ccc3N(C(=O)[C@@H](C)c3ccccc3)C2)c1 |
| InChI | InChI=1S/C30H29F6NO3/c1-18-9-10-19(2)26(15-18)40-24-13-11-22-16-23(28(39,29(31,32)33)30(34,35)36)12-14-25(22)37(17-24)27(38)20(3)21-7-5-4-6-8-21/h4-10,12,14-16,20,24,39H,11,13,17H2,1-3H3/t20-,24-/m0/s1 |
| InChIKey | RLCZCUFWQGNXNO-RDPSFJRHSA-N |
| XLogP | 7.15 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.55 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |