C15H15F6NO2S — CID 58857205
1-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]-2-methylpropan-1-one (PubChem CID 58857205) has the molecular formula C15H15F6NO2S and a molecular weight of 387.35 g/mol. Its IUPAC name is 1-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]-2-methylpropan-1-one.
| Compound Name | 1-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 58857205 |
| Molecular Formula | C15H15F6NO2S |
| Molecular Weight | 387.35 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | 1-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)N1CCSc2cc(C(O)(C(F)(F)F)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C15H15F6NO2S/c1-8(2)12(23)22-5-6-25-11-7-9(3-4-10(11)22)13(24,14(16,17)18)15(19,20)21/h3-4,7-8,24H,5-6H2,1-2H3 |
| InChIKey | DJLJLDGVDJGPEC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.35 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |