C17H19F6NO2S — CID 58857212
1-[(2S)-2-ethyl-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]-2-methylpropan-1-one (PubChem CID 58857212) has the molecular formula C17H19F6NO2S and a molecular weight of 415.40 g/mol. Its IUPAC name is 1-[(2S)-2-ethyl-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]-2-methylpropan-1-one.
| Compound Name | 1-[(2S)-2-ethyl-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 58857212 |
| Molecular Formula | C17H19F6NO2S |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 1-[(2S)-2-ethyl-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]-2-methylpropan-1-one |
| SMILES | CC[C@H]1CN(C(=O)C(C)C)c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2S1 |
| InChI | InChI=1S/C17H19F6NO2S/c1-4-11-8-24(14(25)9(2)3)12-6-5-10(7-13(12)27-11)15(26,16(18,19)20)17(21,22)23/h5-7,9,11,26H,4,8H2,1-3H3/t11-/m0/s1 |
| InChIKey | YOOPDFHMFVZPJA-NSHDSACASA-N |
| XLogP | 4.87 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |