C16H17F6NO3S — CID 58857251
1-[(2S)-2-ethyl-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]-2-methoxyethanone (PubChem CID 58857251) has the molecular formula C16H17F6NO3S and a molecular weight of 417.37 g/mol. Its IUPAC name is 1-[(2S)-2-ethyl-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]-2-methoxyethanone.
| Compound Name | 1-[(2S)-2-ethyl-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]-2-methoxyethanone |
|---|---|
| PubChem CID | 58857251 |
| Molecular Formula | C16H17F6NO3S |
| Molecular Weight | 417.37 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | 1-[(2S)-2-ethyl-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]-2-methoxyethanone |
| SMILES | CC[C@H]1CN(C(=O)COC)c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2S1 |
| InChI | InChI=1S/C16H17F6NO3S/c1-3-10-7-23(13(24)8-26-2)11-5-4-9(6-12(11)27-10)14(25,15(17,18)19)16(20,21)22/h4-6,10,25H,3,7-8H2,1-2H3/t10-/m0/s1 |
| InChIKey | HFBOLMSEHXAMPP-JTQLQIEISA-N |
| XLogP | 3.86 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.37 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |