C17H20F6N2O2S — CID 58857254
2-(dimethylamino)-1-[(2S)-2-ethyl-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]ethanone (PubChem CID 58857254) has the molecular formula C17H20F6N2O2S and a molecular weight of 430.41 g/mol. Its IUPAC name is 2-(dimethylamino)-1-[(2S)-2-ethyl-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]ethanone.
| Compound Name | 2-(dimethylamino)-1-[(2S)-2-ethyl-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]ethanone |
|---|---|
| PubChem CID | 58857254 |
| Molecular Formula | C17H20F6N2O2S |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 2-(dimethylamino)-1-[(2S)-2-ethyl-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]ethanone |
| SMILES | CC[C@H]1CN(C(=O)CN(C)C)c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2S1 |
| InChI | InChI=1S/C17H20F6N2O2S/c1-4-11-8-25(14(26)9-24(2)3)12-6-5-10(7-13(12)28-11)15(27,16(18,19)20)17(21,22)23/h5-7,11,27H,4,8-9H2,1-3H3/t11-/m0/s1 |
| InChIKey | JNKUHSKZNHJATE-NSHDSACASA-N |
| XLogP | 3.78 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |