C18H21F6NO2S — CID 58857259
1-[(2S)-2-ethyl-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]-3-methylbutan-1-one (PubChem CID 58857259) has the molecular formula C18H21F6NO2S and a molecular weight of 429.43 g/mol. Its IUPAC name is 1-[(2S)-2-ethyl-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]-3-methylbutan-1-one.
| Compound Name | 1-[(2S)-2-ethyl-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 58857259 |
| Molecular Formula | C18H21F6NO2S |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | 1-[(2S)-2-ethyl-7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]-3-methylbutan-1-one |
| SMILES | CC[C@H]1CN(C(=O)CC(C)C)c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2S1 |
| InChI | InChI=1S/C18H21F6NO2S/c1-4-12-9-25(15(26)7-10(2)3)13-6-5-11(8-14(13)28-12)16(27,17(19,20)21)18(22,23)24/h5-6,8,10,12,27H,4,7,9H2,1-3H3/t12-/m0/s1 |
| InChIKey | NFAQOBGVZYWKHN-LBPRGKRZSA-N |
| XLogP | 5.26 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |