About [(2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]methyl 4-methylbenzenesulfonate
[(2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 58858608) has the molecular formula C19H30O6SSi
and a molecular weight of 414.60 g/mol. Its IUPAC name is [(2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]methyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [(2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]methyl 4-methylbenzenesulfonate |
| PubChem CID | 58858608 |
| Molecular Formula | C19H30O6SSi |
| Molecular Weight | 414.60 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | [(2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H]2C[C@H](O[Si](C)(C)C(C)(C)C)CC(=O)O2)cc1 |
| InChI | InChI=1S/C19H30O6SSi/c1-14-7-9-17(10-8-14)26(21,22)23-13-16-11-15(12-18(20)24-16)25-27(5,6)19(2,3)4/h7-10,15-16H,11-13H2,1-6H3/t15-,16-/m0/s1 |
| InChIKey | ZRMCTCWVSHERPN-HOTGVXAUSA-N |
| XLogP | 3.80 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.60 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]methyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]methyl 4-methylbenzenesulfonate?
The IUPAC name of [(2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]methyl 4-methylbenzenesulfonate (CID 58858608) is [(2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]methyl 4-methylbenzenesulfonate.
What is the SMILES notation for [(2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]methyl 4-methylbenzenesulfonate?
The canonical SMILES for [(2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]methyl 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OC[C@@H]2C[C@H](O[Si](C)(C)C(C)(C)C)CC(=O)O2)cc1.
What is the InChIKey of [(2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]methyl 4-methylbenzenesulfonate?
The InChIKey is ZRMCTCWVSHERPN-HOTGVXAUSA-N. The full InChI is InChI=1S/C19H30O6SSi/c1-14-7-9-17(10-8-14)26(21,22)23-13-16-11-15(12-18(20)24-16)25-27(5,6)19(2,3)4/h7-10,15-16H,11-13H2,1-6H3/t15-,16-/m0/s1.
What are the key properties of [(2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]methyl 4-methylbenzenesulfonate?
[(2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]methyl 4-methylbenzenesulfonate has a molecular weight of 414.60 g/mol, XLogP of 3.80, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]methyl 4-methylbenzenesulfonate is sourced from PubChem (CID 58858608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).