About 3-hydroxypropyl N,N-dibutylcarbamodithioate
3-hydroxypropyl N,N-dibutylcarbamodithioate (PubChem CID 58858695) has the molecular formula C12H25NOS2
and a molecular weight of 263.47 g/mol. Its IUPAC name is 3-hydroxypropyl N,N-dibutylcarbamodithioate.
Molecular Properties
| Compound Name | 3-hydroxypropyl N,N-dibutylcarbamodithioate |
| PubChem CID | 58858695 |
| Molecular Formula | C12H25NOS2 |
| Molecular Weight | 263.47 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 3-hydroxypropyl N,N-dibutylcarbamodithioate |
| SMILES | CCCCN(CCCC)C(=S)SCCCO |
| InChI | InChI=1S/C12H25NOS2/c1-3-5-8-13(9-6-4-2)12(15)16-11-7-10-14/h14H,3-11H2,1-2H3 |
| InChIKey | YQTCRSURJFKFMT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxypropyl N,N-dibutylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxypropyl N,N-dibutylcarbamodithioate?
The IUPAC name of 3-hydroxypropyl N,N-dibutylcarbamodithioate (CID 58858695) is 3-hydroxypropyl N,N-dibutylcarbamodithioate.
What is the SMILES notation for 3-hydroxypropyl N,N-dibutylcarbamodithioate?
The canonical SMILES for 3-hydroxypropyl N,N-dibutylcarbamodithioate is CCCCN(CCCC)C(=S)SCCCO.
What is the InChIKey of 3-hydroxypropyl N,N-dibutylcarbamodithioate?
The InChIKey is YQTCRSURJFKFMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NOS2/c1-3-5-8-13(9-6-4-2)12(15)16-11-7-10-14/h14H,3-11H2,1-2H3.
What are the key properties of 3-hydroxypropyl N,N-dibutylcarbamodithioate?
3-hydroxypropyl N,N-dibutylcarbamodithioate has a molecular weight of 263.47 g/mol, XLogP of 3.29, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxypropyl N,N-dibutylcarbamodithioate is sourced from PubChem (CID 58858695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).