About curium;propan-2-yl 2-[2-[dihydroxymethyl-[dimethyl(trimethylsilyloxy)silyl]-λ3-iodanyl]ethoxy]acetate
curium;propan-2-yl 2-[2-[dihydroxymethyl-[dimethyl(trimethylsilyloxy)silyl]-λ3-iodanyl]ethoxy]acetate (PubChem CID 58858704) has the molecular formula C13H31CmIO6Si2
and a molecular weight of 713.46 g/mol. Its IUPAC name is curium;propan-2-yl 2-[2-[dihydroxymethyl-[dimethyl(trimethylsilyloxy)silyl]-λ3-iodanyl]ethoxy]acetate.
Molecular Properties
| Compound Name | curium;propan-2-yl 2-[2-[dihydroxymethyl-[dimethyl(trimethylsilyloxy)silyl]-λ3-iodanyl]ethoxy]acetate |
| PubChem CID | 58858704 |
| Molecular Formula | C13H31CmIO6Si2 |
| Molecular Weight | 713.46 g/mol |
| Exact Mass | 709.13 |
| IUPAC Name | curium;propan-2-yl 2-[2-[dihydroxymethyl-[dimethyl(trimethylsilyloxy)silyl]-λ3-iodanyl]ethoxy]acetate |
| SMILES | CC(C)OC(=O)COCCI(C(O)O)[Si](C)(C)O[Si](C)(C)C.[Cm] |
| InChI | InChI=1S/C13H31IO6Si2.Cm/c1-11(2)19-12(15)10-18-9-8-14(13(16)17)22(6,7)20-21(3,4)5;/h11,13,16-17H,8-10H2,1-7H3; |
| InChIKey | HOVAZESJZOGQSN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 713.46 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze curium;propan-2-yl 2-[2-[dihydroxymethyl-[dimethyl(trimethylsilyloxy)silyl]-λ3-iodanyl]ethoxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of curium;propan-2-yl 2-[2-[dihydroxymethyl-[dimethyl(trimethylsilyloxy)silyl]-λ3-iodanyl]ethoxy]acetate?
The IUPAC name of curium;propan-2-yl 2-[2-[dihydroxymethyl-[dimethyl(trimethylsilyloxy)silyl]-λ3-iodanyl]ethoxy]acetate (CID 58858704) is curium;propan-2-yl 2-[2-[dihydroxymethyl-[dimethyl(trimethylsilyloxy)silyl]-λ3-iodanyl]ethoxy]acetate.
What is the SMILES notation for curium;propan-2-yl 2-[2-[dihydroxymethyl-[dimethyl(trimethylsilyloxy)silyl]-λ3-iodanyl]ethoxy]acetate?
The canonical SMILES for curium;propan-2-yl 2-[2-[dihydroxymethyl-[dimethyl(trimethylsilyloxy)silyl]-λ3-iodanyl]ethoxy]acetate is CC(C)OC(=O)COCCI(C(O)O)[Si](C)(C)O[Si](C)(C)C.[Cm].
What is the InChIKey of curium;propan-2-yl 2-[2-[dihydroxymethyl-[dimethyl(trimethylsilyloxy)silyl]-λ3-iodanyl]ethoxy]acetate?
The InChIKey is HOVAZESJZOGQSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H31IO6Si2.Cm/c1-11(2)19-12(15)10-18-9-8-14(13(16)17)22(6,7)20-21(3,4)5;/h11,13,16-17H,8-10H2,1-7H3;.
What are the key properties of curium;propan-2-yl 2-[2-[dihydroxymethyl-[dimethyl(trimethylsilyloxy)silyl]-λ3-iodanyl]ethoxy]acetate?
curium;propan-2-yl 2-[2-[dihydroxymethyl-[dimethyl(trimethylsilyloxy)silyl]-λ3-iodanyl]ethoxy]acetate has a molecular weight of 713.46 g/mol, XLogP of 2.28, 10 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for curium;propan-2-yl 2-[2-[dihydroxymethyl-[dimethyl(trimethylsilyloxy)silyl]-λ3-iodanyl]ethoxy]acetate is sourced from PubChem (CID 58858704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).