About 2-[4-(aminomethyl)-1,3-thiazolidin-3-yl]ethanol
2-[4-(aminomethyl)-1,3-thiazolidin-3-yl]ethanol (PubChem CID 58858749) has the molecular formula C6H14N2OS
and a molecular weight of 162.26 g/mol. Its IUPAC name is 2-[4-(aminomethyl)-1,3-thiazolidin-3-yl]ethanol.
Molecular Properties
| Compound Name | 2-[4-(aminomethyl)-1,3-thiazolidin-3-yl]ethanol |
| PubChem CID | 58858749 |
| Molecular Formula | C6H14N2OS |
| Molecular Weight | 162.26 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 2-[4-(aminomethyl)-1,3-thiazolidin-3-yl]ethanol |
| SMILES | NCC1CSCN1CCO |
| InChI | InChI=1S/C6H14N2OS/c7-3-6-4-10-5-8(6)1-2-9/h6,9H,1-5,7H2 |
| InChIKey | BMPXPKHSICYVJY-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.26 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-(aminomethyl)-1,3-thiazolidin-3-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(aminomethyl)-1,3-thiazolidin-3-yl]ethanol?
The IUPAC name of 2-[4-(aminomethyl)-1,3-thiazolidin-3-yl]ethanol (CID 58858749) is 2-[4-(aminomethyl)-1,3-thiazolidin-3-yl]ethanol.
What is the SMILES notation for 2-[4-(aminomethyl)-1,3-thiazolidin-3-yl]ethanol?
The canonical SMILES for 2-[4-(aminomethyl)-1,3-thiazolidin-3-yl]ethanol is NCC1CSCN1CCO.
What is the InChIKey of 2-[4-(aminomethyl)-1,3-thiazolidin-3-yl]ethanol?
The InChIKey is BMPXPKHSICYVJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2OS/c7-3-6-4-10-5-8(6)1-2-9/h6,9H,1-5,7H2.
What are the key properties of 2-[4-(aminomethyl)-1,3-thiazolidin-3-yl]ethanol?
2-[4-(aminomethyl)-1,3-thiazolidin-3-yl]ethanol has a molecular weight of 162.26 g/mol, XLogP of -0.69, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(aminomethyl)-1,3-thiazolidin-3-yl]ethanol is sourced from PubChem (CID 58858749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).