C21H25N6O2S+ — CID 58859011
1-(2,6-dimethylphenyl)-1-[3-[3-(5-sulfanylidene-2H-tetrazol-1-yl)anilino]propyl]aziridin-1-ium-2-carboxylic acid (PubChem CID 58859011) has the molecular formula C21H25N6O2S+ and a molecular weight of 425.54 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-1-[3-[3-(5-sulfanylidene-2H-tetrazol-1-yl)anilino]propyl]aziridin-1-ium-2-carboxylic acid.
| Compound Name | 1-(2,6-dimethylphenyl)-1-[3-[3-(5-sulfanylidene-2H-tetrazol-1-yl)anilino]propyl]aziridin-1-ium-2-carboxylic acid |
|---|---|
| PubChem CID | 58859011 |
| Molecular Formula | C21H25N6O2S+ |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-1-[3-[3-(5-sulfanylidene-2H-tetrazol-1-yl)anilino]propyl]aziridin-1-ium-2-carboxylic acid |
| SMILES | Cc1cccc(C)c1[N+]1(CCCNc2cccc(-n3[nH]nnc3=S)c2)CC1C(=O)O |
| InChI | InChI=1S/C21H24N6O2S/c1-14-6-3-7-15(2)19(14)27(13-18(27)20(28)29)11-5-10-22-16-8-4-9-17(12-16)26-21(30)23-24-25-26/h3-4,6-9,12,18,22H,5,10-11,13H2,1-2H3,(H-,23,25,28,29,30)/p+1 |
| InChIKey | PGMJGFQDUYRDPI-UHFFFAOYSA-O |
| XLogP | 3.22 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|