C26H13N4O2+ — CID 58860123
10,17,24-triaza-3-azoniaoctacyclo[13.13.2.02,10.04,9.012,29.017,25.018,23.026,30]triaconta-1(29),2,4,6,8,12,14,18,20,22,24,26(30),27-tridecaene-11,16-dione (PubChem CID 58860123) has the molecular formula C26H13N4O2+ and a molecular weight of 413.42 g/mol. Its IUPAC name is 10,17,24-triaza-3-azoniaoctacyclo[13.13.2.02,10.04,9.012,29.017,25.018,23.026,30]triaconta-1(29),2,4,6,8,12,14,18,20,22,24,26(30),27-tridecaene-11,16-dione.
| Compound Name | 10,17,24-triaza-3-azoniaoctacyclo[13.13.2.02,10.04,9.012,29.017,25.018,23.026,30]triaconta-1(29),2,4,6,8,12,14,18,20,22,24,26(30),27-tridecaene-11,16-dione |
|---|---|
| PubChem CID | 58860123 |
| Molecular Formula | C26H13N4O2+ |
| Molecular Weight | 413.42 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 10,17,24-triaza-3-azoniaoctacyclo[13.13.2.02,10.04,9.012,29.017,25.018,23.026,30]triaconta-1(29),2,4,6,8,12,14,18,20,22,24,26(30),27-tridecaene-11,16-dione |
| SMILES | O=c1c2ccc3c(=O)n4c5ccccc5[nH+]c4c4ccc(c2c34)c2nc3ccccc3n12 |
| InChI | InChI=1S/C26H12N4O2/c31-25-15-11-12-16-22-14(24-28-18-6-2-4-8-20(18)30(24)26(16)32)10-9-13(21(15)22)23-27-17-5-1-3-7-19(17)29(23)25/h1-12H/p+1 |
| InChIKey | YMEPVPIIHONYLV-UHFFFAOYSA-O |
| XLogP | 3.76 |
| TPSA | 69.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|