C18H32O7 — CID 58860259
1-[(3aR,5R,6S,6aR)-6-(1-butoxyethoxy)spiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane]-5-yl]ethane-1,2-diol (PubChem CID 58860259) has the molecular formula C18H32O7 and a molecular weight of 360.45 g/mol. Its IUPAC name is 1-[(3aR,5R,6S,6aR)-6-(1-butoxyethoxy)spiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane]-5-yl]ethane-1,2-diol.
| Compound Name | 1-[(3aR,5R,6S,6aR)-6-(1-butoxyethoxy)spiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane]-5-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 58860259 |
| Molecular Formula | C18H32O7 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | 1-[(3aR,5R,6S,6aR)-6-(1-butoxyethoxy)spiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane]-5-yl]ethane-1,2-diol |
| SMILES | CCCCOC(C)O[C@@H]1[C@H]2OC3(CCCCC3)O[C@H]2O[C@@H]1C(O)CO |
| InChI | InChI=1S/C18H32O7/c1-3-4-10-21-12(2)22-15-14(13(20)11-19)23-17-16(15)24-18(25-17)8-6-5-7-9-18/h12-17,19-20H,3-11H2,1-2H3/t12?,13?,14-,15+,16-,17-/m1/s1 |
| InChIKey | IXPGLRWJBMNBLU-VONXPYPISA-N |
| XLogP | 1.69 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|