C10H18O3 — CID 58860261
1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1,3,5-triol (PubChem CID 58860261) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1,3,5-triol.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1,3,5-triol |
|---|---|
| PubChem CID | 58860261 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1,3,5-triol |
| SMILES | OC1CC(O)C2CCCC(O)C2C1 |
| InChI | InChI=1S/C10H18O3/c11-6-4-8-7(10(13)5-6)2-1-3-9(8)12/h6-13H,1-5H2 |
| InChIKey | INPAQXKWURBKMV-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |