C7H5F9O — CID 58860327
1,1,1,4,4,4-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)butane (PubChem CID 58860327) has the molecular formula C7H5F9O and a molecular weight of 276.10 g/mol. Its IUPAC name is 1,1,1,4,4,4-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)butane.
| Compound Name | 1,1,1,4,4,4-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)butane |
|---|---|
| PubChem CID | 58860327 |
| Molecular Formula | C7H5F9O |
| Molecular Weight | 276.10 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | 1,1,1,4,4,4-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)butane |
| SMILES | C=C(F)C(F)(F)OC(CC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H5F9O/c1-3(8)7(15,16)17-4(6(12,13)14)2-5(9,10)11/h4H,1-2H2 |
| InChIKey | AAKQDOIVZFMOEK-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.10 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |