C22H30N4O8S — CID 58860394
2-[3-(acetylsulfanylmethyl)-4-[2-[[(2S)-3-hydroxy-2-[3-(propanoylamino)propanoylamino]propanoyl]amino]ethyl]anilino]-2-oxoacetic acid (PubChem CID 58860394) has the molecular formula C22H30N4O8S and a molecular weight of 510.57 g/mol. Its IUPAC name is 2-[3-(acetylsulfanylmethyl)-4-[2-[[(2S)-3-hydroxy-2-[3-(propanoylamino)propanoylamino]propanoyl]amino]ethyl]anilino]-2-oxoacetic acid.
| Compound Name | 2-[3-(acetylsulfanylmethyl)-4-[2-[[(2S)-3-hydroxy-2-[3-(propanoylamino)propanoylamino]propanoyl]amino]ethyl]anilino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 58860394 |
| Molecular Formula | C22H30N4O8S |
| Molecular Weight | 510.57 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | 2-[3-(acetylsulfanylmethyl)-4-[2-[[(2S)-3-hydroxy-2-[3-(propanoylamino)propanoylamino]propanoyl]amino]ethyl]anilino]-2-oxoacetic acid |
| SMILES | CCC(=O)NCCC(=O)N[C@@H](CO)C(=O)NCCc1ccc(NC(=O)C(=O)O)cc1CSC(C)=O |
| InChI | InChI=1S/C22H30N4O8S/c1-3-18(29)23-9-7-19(30)26-17(11-27)20(31)24-8-6-14-4-5-16(25-21(32)22(33)34)10-15(14)12-35-13(2)28/h4-5,10,17,27H,3,6-9,11-12H2,1-2H3,(H,23,29)(H,24,31)(H,25,32)(H,26,30)(H,33,34)/t17-/m0/s1 |
| InChIKey | GGRFHDMDPPLTIR-KRWDZBQOSA-N |
| XLogP | -0.46 |
| TPSA | 191.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.57 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|