C12H9FN2S2 — CID 58860652
8-fluoro-2-methyl-5,10-dihydrothieno[3,2-c][1,5]benzodiazepine-4-thione (PubChem CID 58860652) has the molecular formula C12H9FN2S2 and a molecular weight of 264.35 g/mol. Its IUPAC name is 8-fluoro-2-methyl-5,10-dihydrothieno[3,2-c][1,5]benzodiazepine-4-thione.
| Compound Name | 8-fluoro-2-methyl-5,10-dihydrothieno[3,2-c][1,5]benzodiazepine-4-thione |
|---|---|
| PubChem CID | 58860652 |
| Molecular Formula | C12H9FN2S2 |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | 8-fluoro-2-methyl-5,10-dihydrothieno[3,2-c][1,5]benzodiazepine-4-thione |
| SMILES | Cc1cc2c(s1)Nc1cc(F)ccc1NC2=S |
| InChI | InChI=1S/C12H9FN2S2/c1-6-4-8-11(16)14-9-3-2-7(13)5-10(9)15-12(8)17-6/h2-5,15H,1H3,(H,14,16) |
| InChIKey | TZCVZXJVGDLGBI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|