C30H40BrF2N3O4Si — CID 58860914
tert-butyl 4-[(4-bromophenyl)-[5,6-difluoro-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]-hydroxymethyl]piperidine-1-carboxylate (PubChem CID 58860914) has the molecular formula C30H40BrF2N3O4Si and a molecular weight of 652.65 g/mol. Its IUPAC name is tert-butyl 4-[(4-bromophenyl)-[5,6-difluoro-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]-hydroxymethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(4-bromophenyl)-[5,6-difluoro-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]-hydroxymethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58860914 |
| Molecular Formula | C30H40BrF2N3O4Si |
| Molecular Weight | 652.65 g/mol |
| Exact Mass | 651.19 |
| IUPAC Name | tert-butyl 4-[(4-bromophenyl)-[5,6-difluoro-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]-hydroxymethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(O)(c2ccc(Br)cc2)c2nc3cc(F)c(F)cc3n2COCC[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C30H40BrF2N3O4Si/c1-29(2,3)40-28(37)35-13-11-21(12-14-35)30(38,20-7-9-22(31)10-8-20)27-34-25-17-23(32)24(33)18-26(25)36(27)19-39-15-16-41(4,5)6/h7-10,17-18,21,38H,11-16,19H2,1-6H3 |
| InChIKey | RQOZSUHFHBXTAF-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.65 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|