About N-hydroxy-N'-[4-(4-hydroxypiperidin-1-yl)-3-methylphenyl]methanimidamide
N-hydroxy-N'-[4-(4-hydroxypiperidin-1-yl)-3-methylphenyl]methanimidamide (PubChem CID 58861151) has the molecular formula C13H19N3O2
and a molecular weight of 249.31 g/mol. Its IUPAC name is N-hydroxy-N'-[4-(4-hydroxypiperidin-1-yl)-3-methylphenyl]methanimidamide.
Molecular Properties
| Compound Name | N-hydroxy-N'-[4-(4-hydroxypiperidin-1-yl)-3-methylphenyl]methanimidamide |
| PubChem CID | 58861151 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | N-hydroxy-N'-[4-(4-hydroxypiperidin-1-yl)-3-methylphenyl]methanimidamide |
| SMILES | Cc1cc(/N=C/NO)ccc1N1CCC(O)CC1 |
| InChI | InChI=1S/C13H19N3O2/c1-10-8-11(14-9-15-18)2-3-13(10)16-6-4-12(17)5-7-16/h2-3,8-9,12,17-18H,4-7H2,1H3,(H,14,15) |
| InChIKey | ZRSRKTDKXFKBTE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 68.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxy-N'-[4-(4-hydroxypiperidin-1-yl)-3-methylphenyl]methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxy-N'-[4-(4-hydroxypiperidin-1-yl)-3-methylphenyl]methanimidamide?
The IUPAC name of N-hydroxy-N'-[4-(4-hydroxypiperidin-1-yl)-3-methylphenyl]methanimidamide (CID 58861151) is N-hydroxy-N'-[4-(4-hydroxypiperidin-1-yl)-3-methylphenyl]methanimidamide.
What is the SMILES notation for N-hydroxy-N'-[4-(4-hydroxypiperidin-1-yl)-3-methylphenyl]methanimidamide?
The canonical SMILES for N-hydroxy-N'-[4-(4-hydroxypiperidin-1-yl)-3-methylphenyl]methanimidamide is Cc1cc(/N=C/NO)ccc1N1CCC(O)CC1.
What is the InChIKey of N-hydroxy-N'-[4-(4-hydroxypiperidin-1-yl)-3-methylphenyl]methanimidamide?
The InChIKey is ZRSRKTDKXFKBTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O2/c1-10-8-11(14-9-15-18)2-3-13(10)16-6-4-12(17)5-7-16/h2-3,8-9,12,17-18H,4-7H2,1H3,(H,14,15).
What are the key properties of N-hydroxy-N'-[4-(4-hydroxypiperidin-1-yl)-3-methylphenyl]methanimidamide?
N-hydroxy-N'-[4-(4-hydroxypiperidin-1-yl)-3-methylphenyl]methanimidamide has a molecular weight of 249.31 g/mol, XLogP of 1.59, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxy-N'-[4-(4-hydroxypiperidin-1-yl)-3-methylphenyl]methanimidamide is sourced from PubChem (CID 58861151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).