C19H40N4 — CID 58861185
N'-(1,2-dimethyl-2,6,6-tritritiopiperidin-4-yl)-N'-ethyl-N-methyl-N-(1,2,2-trimethyl-6,6-ditritiopiperidin-4-yl)methanediamine (PubChem CID 58861185) has the molecular formula C19H40N4 and a molecular weight of 334.60 g/mol. Its IUPAC name is N'-(1,2-dimethyl-2,6,6-tritritiopiperidin-4-yl)-N'-ethyl-N-methyl-N-(1,2,2-trimethyl-6,6-ditritiopiperidin-4-yl)methanediamine.
| Compound Name | N'-(1,2-dimethyl-2,6,6-tritritiopiperidin-4-yl)-N'-ethyl-N-methyl-N-(1,2,2-trimethyl-6,6-ditritiopiperidin-4-yl)methanediamine |
|---|---|
| PubChem CID | 58861185 |
| Molecular Formula | C19H40N4 |
| Molecular Weight | 334.60 g/mol |
| Exact Mass | 334.37 |
| IUPAC Name | N'-(1,2-dimethyl-2,6,6-tritritiopiperidin-4-yl)-N'-ethyl-N-methyl-N-(1,2,2-trimethyl-6,6-ditritiopiperidin-4-yl)methanediamine |
| SMILES | [3H]C1([3H])CC(N(CC)CN(C)C2CC([3H])([3H])N(C)C(C)(C)C2)CC([3H])(C)N1C |
| InChI | InChI=1S/C19H40N4/c1-8-23(17-9-11-20(5)16(2)13-17)15-21(6)18-10-12-22(7)19(3,4)14-18/h16-18H,8-15H2,1-7H3/i11T2,12T2,16T |
| InChIKey | SKMVETVAJLUYSH-UKGHWYKQSA-N |
| XLogP | 2.55 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.60 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|