About (E)-2,4,5-trimethylhex-3-en-3-amine
(E)-2,4,5-trimethylhex-3-en-3-amine (PubChem CID 58861518) has the molecular formula C9H19N
and a molecular weight of 141.26 g/mol. Its IUPAC name is (E)-2,4,5-trimethylhex-3-en-3-amine.
Molecular Properties
| Compound Name | (E)-2,4,5-trimethylhex-3-en-3-amine |
| PubChem CID | 58861518 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | (E)-2,4,5-trimethylhex-3-en-3-amine |
| SMILES | C/C(=C(\N)C(C)C)C(C)C |
| InChI | InChI=1S/C9H19N/c1-6(2)8(5)9(10)7(3)4/h6-7H,10H2,1-5H3/b9-8+ |
| InChIKey | PRYFQWXDRWQLRP-CMDGGOBGSA-N |
| XLogP | 2.53 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (E)-2,4,5-trimethylhex-3-en-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,4,5-trimethylhex-3-en-3-amine?
The IUPAC name of (E)-2,4,5-trimethylhex-3-en-3-amine (CID 58861518) is (E)-2,4,5-trimethylhex-3-en-3-amine.
What is the SMILES notation for (E)-2,4,5-trimethylhex-3-en-3-amine?
The canonical SMILES for (E)-2,4,5-trimethylhex-3-en-3-amine is C/C(=C(\N)C(C)C)C(C)C.
What is the InChIKey of (E)-2,4,5-trimethylhex-3-en-3-amine?
The InChIKey is PRYFQWXDRWQLRP-CMDGGOBGSA-N. The full InChI is InChI=1S/C9H19N/c1-6(2)8(5)9(10)7(3)4/h6-7H,10H2,1-5H3/b9-8+.
What are the key properties of (E)-2,4,5-trimethylhex-3-en-3-amine?
(E)-2,4,5-trimethylhex-3-en-3-amine has a molecular weight of 141.26 g/mol, XLogP of 2.53, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,4,5-trimethylhex-3-en-3-amine is sourced from PubChem (CID 58861518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).