About heptan-3-yl piperazine-1-carboxylate
heptan-3-yl piperazine-1-carboxylate (PubChem CID 58861606) has the molecular formula C12H24N2O2
and a molecular weight of 228.34 g/mol. Its IUPAC name is heptan-3-yl piperazine-1-carboxylate.
Molecular Properties
| Compound Name | heptan-3-yl piperazine-1-carboxylate |
| PubChem CID | 58861606 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | heptan-3-yl piperazine-1-carboxylate |
| SMILES | CCCCC(CC)OC(=O)N1CCNCC1 |
| InChI | InChI=1S/C12H24N2O2/c1-3-5-6-11(4-2)16-12(15)14-9-7-13-8-10-14/h11,13H,3-10H2,1-2H3 |
| InChIKey | QRTVTQQAVGKUFL-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze heptan-3-yl piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptan-3-yl piperazine-1-carboxylate?
The IUPAC name of heptan-3-yl piperazine-1-carboxylate (CID 58861606) is heptan-3-yl piperazine-1-carboxylate.
What is the SMILES notation for heptan-3-yl piperazine-1-carboxylate?
The canonical SMILES for heptan-3-yl piperazine-1-carboxylate is CCCCC(CC)OC(=O)N1CCNCC1.
What is the InChIKey of heptan-3-yl piperazine-1-carboxylate?
The InChIKey is QRTVTQQAVGKUFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O2/c1-3-5-6-11(4-2)16-12(15)14-9-7-13-8-10-14/h11,13H,3-10H2,1-2H3.
What are the key properties of heptan-3-yl piperazine-1-carboxylate?
heptan-3-yl piperazine-1-carboxylate has a molecular weight of 228.34 g/mol, XLogP of 2.00, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for heptan-3-yl piperazine-1-carboxylate is sourced from PubChem (CID 58861606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).