C20H26F6O2 — CID 58861678
[5,5,5-trifluoro-4-methyl-4-(trifluoromethyl)pentyl] tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate (PubChem CID 58861678) has the molecular formula C20H26F6O2 and a molecular weight of 412.41 g/mol. Its IUPAC name is [5,5,5-trifluoro-4-methyl-4-(trifluoromethyl)pentyl] tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate.
| Compound Name | [5,5,5-trifluoro-4-methyl-4-(trifluoromethyl)pentyl] tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
|---|---|
| PubChem CID | 58861678 |
| Molecular Formula | C20H26F6O2 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | [5,5,5-trifluoro-4-methyl-4-(trifluoromethyl)pentyl] tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
| SMILES | CC(CCCOC(=O)C1CC2CC1C1C3CCC(C3)C21)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C20H26F6O2/c1-18(19(21,22)23,20(24,25)26)5-2-6-28-17(27)14-9-12-8-13(14)16-11-4-3-10(7-11)15(12)16/h10-16H,2-9H2,1H3 |
| InChIKey | LMBIMGGXPFAKQE-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|