C11H15N — CID 58862021
N-methyl-5,6,7,8-tetrahydro-1H-azulen-4-imine (PubChem CID 58862021) has the molecular formula C11H15N and a molecular weight of 161.24 g/mol. Its IUPAC name is N-methyl-5,6,7,8-tetrahydro-1H-azulen-4-imine.
| Compound Name | N-methyl-5,6,7,8-tetrahydro-1H-azulen-4-imine |
|---|---|
| PubChem CID | 58862021 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.24 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | N-methyl-5,6,7,8-tetrahydro-1H-azulen-4-imine |
| SMILES | CN=C1CCCCC2=C1C=CC2 |
| InChI | InChI=1S/C11H15N/c1-12-11-8-3-2-5-9-6-4-7-10(9)11/h4,7H,2-3,5-6,8H2,1H3 |
| InChIKey | AISRBYHFXOFQCN-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 12.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | 269 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.24 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|