About 3-methyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-amine
3-methyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-amine (PubChem CID 58862031) has the molecular formula C8H11NS
and a molecular weight of 153.25 g/mol. Its IUPAC name is 3-methyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-amine.
Molecular Properties
| Compound Name | 3-methyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-amine |
| PubChem CID | 58862031 |
| Molecular Formula | C8H11NS |
| Molecular Weight | 153.25 g/mol |
| Exact Mass | 153.06 |
| IUPAC Name | 3-methyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-amine |
| SMILES | Cc1c(N)sc2c1CCC2 |
| InChI | InChI=1S/C8H11NS/c1-5-6-3-2-4-7(6)10-8(5)9/h2-4,9H2,1H3 |
| InChIKey | ZAUKRUPBUFTPHG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.25 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-amine?
The IUPAC name of 3-methyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-amine (CID 58862031) is 3-methyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-amine.
What is the SMILES notation for 3-methyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-amine?
The canonical SMILES for 3-methyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-amine is Cc1c(N)sc2c1CCC2.
What is the InChIKey of 3-methyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-amine?
The InChIKey is ZAUKRUPBUFTPHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NS/c1-5-6-3-2-4-7(6)10-8(5)9/h2-4,9H2,1H3.
What are the key properties of 3-methyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-amine?
3-methyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-amine has a molecular weight of 153.25 g/mol, XLogP of 2.13, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-amine is sourced from PubChem (CID 58862031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).