C9H12NRbS — CID 58862036
3-methyl-4,5,6,7-tetrahydro-1-benzothiophen-5-id-2-amine;rubidium(1+) (PubChem CID 58862036) has the molecular formula C9H12NRbS and a molecular weight of 251.74 g/mol. Its IUPAC name is 3-methyl-4,5,6,7-tetrahydro-1-benzothiophen-5-id-2-amine;rubidium(1+).
| Compound Name | 3-methyl-4,5,6,7-tetrahydro-1-benzothiophen-5-id-2-amine;rubidium(1+) |
|---|---|
| PubChem CID | 58862036 |
| Molecular Formula | C9H12NRbS |
| Molecular Weight | 251.74 g/mol |
| Exact Mass | 250.98 |
| IUPAC Name | 3-methyl-4,5,6,7-tetrahydro-1-benzothiophen-5-id-2-amine;rubidium(1+) |
| SMILES | Cc1c(N)sc2c1C[CH-]CC2.[Rb+] |
| InChI | InChI=1S/C9H12NS.Rb/c1-6-7-4-2-3-5-8(7)11-9(6)10;/h2H,3-5,10H2,1H3;/q-1;+1 |
| InChIKey | CTHXTEOICURJTD-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.74 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|