About (5R)-5-(azidomethyl)-2-methylidene-3-(4-piperazin-1-ylphenyl)-1,3-oxazolidine
(5R)-5-(azidomethyl)-2-methylidene-3-(4-piperazin-1-ylphenyl)-1,3-oxazolidine (PubChem CID 58862057) has the molecular formula C15H20N6O
and a molecular weight of 300.37 g/mol. Its IUPAC name is (5R)-5-(azidomethyl)-2-methylidene-3-(4-piperazin-1-ylphenyl)-1,3-oxazolidine.
Molecular Properties
| Compound Name | (5R)-5-(azidomethyl)-2-methylidene-3-(4-piperazin-1-ylphenyl)-1,3-oxazolidine |
| PubChem CID | 58862057 |
| Molecular Formula | C15H20N6O |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | (5R)-5-(azidomethyl)-2-methylidene-3-(4-piperazin-1-ylphenyl)-1,3-oxazolidine |
| SMILES | C=C1O[C@@H](CN=[N+]=[N-])CN1c1ccc(N2CCNCC2)cc1 |
| InChI | InChI=1S/C15H20N6O/c1-12-21(11-15(22-12)10-18-19-16)14-4-2-13(3-5-14)20-8-6-17-7-9-20/h2-5,15,17H,1,6-11H2/t15-/m0/s1 |
| InChIKey | BRAZUUXELNXGPP-HNNXBMFYSA-N |
| XLogP | 2.08 |
| TPSA | 76.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (5R)-5-(azidomethyl)-2-methylidene-3-(4-piperazin-1-ylphenyl)-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-(azidomethyl)-2-methylidene-3-(4-piperazin-1-ylphenyl)-1,3-oxazolidine?
The IUPAC name of (5R)-5-(azidomethyl)-2-methylidene-3-(4-piperazin-1-ylphenyl)-1,3-oxazolidine (CID 58862057) is (5R)-5-(azidomethyl)-2-methylidene-3-(4-piperazin-1-ylphenyl)-1,3-oxazolidine.
What is the SMILES notation for (5R)-5-(azidomethyl)-2-methylidene-3-(4-piperazin-1-ylphenyl)-1,3-oxazolidine?
The canonical SMILES for (5R)-5-(azidomethyl)-2-methylidene-3-(4-piperazin-1-ylphenyl)-1,3-oxazolidine is C=C1O[C@@H](CN=[N+]=[N-])CN1c1ccc(N2CCNCC2)cc1.
What is the InChIKey of (5R)-5-(azidomethyl)-2-methylidene-3-(4-piperazin-1-ylphenyl)-1,3-oxazolidine?
The InChIKey is BRAZUUXELNXGPP-HNNXBMFYSA-N. The full InChI is InChI=1S/C15H20N6O/c1-12-21(11-15(22-12)10-18-19-16)14-4-2-13(3-5-14)20-8-6-17-7-9-20/h2-5,15,17H,1,6-11H2/t15-/m0/s1.
What are the key properties of (5R)-5-(azidomethyl)-2-methylidene-3-(4-piperazin-1-ylphenyl)-1,3-oxazolidine?
(5R)-5-(azidomethyl)-2-methylidene-3-(4-piperazin-1-ylphenyl)-1,3-oxazolidine has a molecular weight of 300.37 g/mol, XLogP of 2.08, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-(azidomethyl)-2-methylidene-3-(4-piperazin-1-ylphenyl)-1,3-oxazolidine is sourced from PubChem (CID 58862057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).