C20H22O2 — CID 58862267
(3aR,4S,9bS)-4-(2,4-dimethylphenyl)-1,2,3,3a,4,9b-hexahydrocyclopenta[c]chromen-8-ol (PubChem CID 58862267) has the molecular formula C20H22O2 and a molecular weight of 294.39 g/mol. Its IUPAC name is (3aR,4S,9bS)-4-(2,4-dimethylphenyl)-1,2,3,3a,4,9b-hexahydrocyclopenta[c]chromen-8-ol.
| Compound Name | (3aR,4S,9bS)-4-(2,4-dimethylphenyl)-1,2,3,3a,4,9b-hexahydrocyclopenta[c]chromen-8-ol |
|---|---|
| PubChem CID | 58862267 |
| Molecular Formula | C20H22O2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | (3aR,4S,9bS)-4-(2,4-dimethylphenyl)-1,2,3,3a,4,9b-hexahydrocyclopenta[c]chromen-8-ol |
| SMILES | Cc1ccc([C@H]2Oc3ccc(O)cc3[C@H]3CCC[C@H]32)c(C)c1 |
| InChI | InChI=1S/C20H22O2/c1-12-6-8-15(13(2)10-12)20-17-5-3-4-16(17)18-11-14(21)7-9-19(18)22-20/h6-11,16-17,20-21H,3-5H2,1-2H3/t16-,17+,20+/m0/s1 |
| InChIKey | SAZCNMNFOHXLTQ-SQGPQFPESA-N |
| XLogP | 5.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |