C20H22O — CID 58862275
(3aR,4S,9bS)-8-methyl-4-(4-methylphenyl)-1,2,3,3a,4,9b-hexahydrocyclopenta[c]chromene (PubChem CID 58862275) has the molecular formula C20H22O and a molecular weight of 278.40 g/mol. Its IUPAC name is (3aR,4S,9bS)-8-methyl-4-(4-methylphenyl)-1,2,3,3a,4,9b-hexahydrocyclopenta[c]chromene.
| Compound Name | (3aR,4S,9bS)-8-methyl-4-(4-methylphenyl)-1,2,3,3a,4,9b-hexahydrocyclopenta[c]chromene |
|---|---|
| PubChem CID | 58862275 |
| Molecular Formula | C20H22O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | (3aR,4S,9bS)-8-methyl-4-(4-methylphenyl)-1,2,3,3a,4,9b-hexahydrocyclopenta[c]chromene |
| SMILES | Cc1ccc([C@H]2Oc3ccc(C)cc3[C@H]3CCC[C@H]32)cc1 |
| InChI | InChI=1S/C20H22O/c1-13-6-9-15(10-7-13)20-17-5-3-4-16(17)18-12-14(2)8-11-19(18)21-20/h6-12,16-17,20H,3-5H2,1-2H3/t16-,17+,20+/m0/s1 |
| InChIKey | QDJJIALMLCXPEX-SQGPQFPESA-N |
| XLogP | 5.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |