About cis-methyl (1S,2R)-2-[2,4-bis(methoxymethoxy)phenyl]cyclopentane-1-carboxylate
cis-methyl (1S,2R)-2-[2,4-bis(methoxymethoxy)phenyl]cyclopentane-1-carboxylate (PubChem CID 58862290) has the molecular formula C17H24O6
and a molecular weight of 324.37 g/mol. Its IUPAC name is cis-methyl (1S,2R)-2-[2,4-bis(methoxymethoxy)phenyl]cyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | cis-methyl (1S,2R)-2-[2,4-bis(methoxymethoxy)phenyl]cyclopentane-1-carboxylate |
| PubChem CID | 58862290 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | cis-methyl (1S,2R)-2-[2,4-bis(methoxymethoxy)phenyl]cyclopentane-1-carboxylate |
| SMILES | COCOc1ccc([C@@H]2CCC[C@@H]2C(=O)OC)c(OCOC)c1 |
| InChI | InChI=1S/C17H24O6/c1-19-10-22-12-7-8-14(16(9-12)23-11-20-2)13-5-4-6-15(13)17(18)21-3/h7-9,13,15H,4-6,10-11H2,1-3H3/t13-,15-/m0/s1 |
| InChIKey | HMQGJZHNLBOVTC-ZFWWWQNUSA-N |
| XLogP | 2.71 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze cis-methyl (1S,2R)-2-[2,4-bis(methoxymethoxy)phenyl]cyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-methyl (1S,2R)-2-[2,4-bis(methoxymethoxy)phenyl]cyclopentane-1-carboxylate?
The IUPAC name of cis-methyl (1S,2R)-2-[2,4-bis(methoxymethoxy)phenyl]cyclopentane-1-carboxylate (CID 58862290) is cis-methyl (1S,2R)-2-[2,4-bis(methoxymethoxy)phenyl]cyclopentane-1-carboxylate.
What is the SMILES notation for cis-methyl (1S,2R)-2-[2,4-bis(methoxymethoxy)phenyl]cyclopentane-1-carboxylate?
The canonical SMILES for cis-methyl (1S,2R)-2-[2,4-bis(methoxymethoxy)phenyl]cyclopentane-1-carboxylate is COCOc1ccc([C@@H]2CCC[C@@H]2C(=O)OC)c(OCOC)c1.
What is the InChIKey of cis-methyl (1S,2R)-2-[2,4-bis(methoxymethoxy)phenyl]cyclopentane-1-carboxylate?
The InChIKey is HMQGJZHNLBOVTC-ZFWWWQNUSA-N. The full InChI is InChI=1S/C17H24O6/c1-19-10-22-12-7-8-14(16(9-12)23-11-20-2)13-5-4-6-15(13)17(18)21-3/h7-9,13,15H,4-6,10-11H2,1-3H3/t13-,15-/m0/s1.
What are the key properties of cis-methyl (1S,2R)-2-[2,4-bis(methoxymethoxy)phenyl]cyclopentane-1-carboxylate?
cis-methyl (1S,2R)-2-[2,4-bis(methoxymethoxy)phenyl]cyclopentane-1-carboxylate has a molecular weight of 324.37 g/mol, XLogP of 2.71, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cis-methyl (1S,2R)-2-[2,4-bis(methoxymethoxy)phenyl]cyclopentane-1-carboxylate is sourced from PubChem (CID 58862290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).