About N-hexan-2-ylethanimine
N-hexan-2-ylethanimine (PubChem CID 58862526) has the molecular formula C8H17N
and a molecular weight of 127.23 g/mol. Its IUPAC name is N-hexan-2-ylethanimine.
Molecular Properties
| Compound Name | N-hexan-2-ylethanimine |
| PubChem CID | 58862526 |
| Molecular Formula | C8H17N |
| Molecular Weight | 127.23 g/mol |
| Exact Mass | 127.14 |
| IUPAC Name | N-hexan-2-ylethanimine |
| SMILES | C/C=N/C(C)CCCC |
| InChI | InChI=1S/C8H17N/c1-4-6-7-8(3)9-5-2/h5,8H,4,6-7H2,1-3H3/b9-5+ |
| InChIKey | AIURLDWRLJJWTQ-WEVVVXLNSA-N |
| XLogP | 2.66 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.23 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-hexan-2-ylethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hexan-2-ylethanimine?
The IUPAC name of N-hexan-2-ylethanimine (CID 58862526) is N-hexan-2-ylethanimine.
What is the SMILES notation for N-hexan-2-ylethanimine?
The canonical SMILES for N-hexan-2-ylethanimine is C/C=N/C(C)CCCC.
What is the InChIKey of N-hexan-2-ylethanimine?
The InChIKey is AIURLDWRLJJWTQ-WEVVVXLNSA-N. The full InChI is InChI=1S/C8H17N/c1-4-6-7-8(3)9-5-2/h5,8H,4,6-7H2,1-3H3/b9-5+.
What are the key properties of N-hexan-2-ylethanimine?
N-hexan-2-ylethanimine has a molecular weight of 127.23 g/mol, XLogP of 2.66, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-hexan-2-ylethanimine is sourced from PubChem (CID 58862526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).