C49H58N6 — CID 58862886
[4-(4-butylpiperazin-1-yl)phenyl]-[4-[[4-[4-[4-(4-pentylcyclohexyl)phenyl]phenyl]phenyl]diazenyl]phenyl]diazene (PubChem CID 58862886) has the molecular formula C49H58N6 and a molecular weight of 731.05 g/mol. Its IUPAC name is [4-(4-butylpiperazin-1-yl)phenyl]-[4-[[4-[4-[4-(4-pentylcyclohexyl)phenyl]phenyl]phenyl]diazenyl]phenyl]diazene.
| Compound Name | [4-(4-butylpiperazin-1-yl)phenyl]-[4-[[4-[4-[4-(4-pentylcyclohexyl)phenyl]phenyl]phenyl]diazenyl]phenyl]diazene |
|---|---|
| PubChem CID | 58862886 |
| Molecular Formula | C49H58N6 |
| Molecular Weight | 731.05 g/mol |
| Exact Mass | 730.47 |
| IUPAC Name | [4-(4-butylpiperazin-1-yl)phenyl]-[4-[[4-[4-[4-(4-pentylcyclohexyl)phenyl]phenyl]phenyl]diazenyl]phenyl]diazene |
| SMILES | CCCCCC1CCC(c2ccc(-c3ccc(-c4ccc(/N=N/c5ccc(/N=N/c6ccc(N7CCN(CCCC)CC7)cc6)cc5)cc4)cc3)cc2)CC1 |
| InChI | InChI=1S/C49H58N6/c1-3-5-7-8-38-9-11-39(12-10-38)40-13-15-41(16-14-40)42-17-19-43(20-18-42)44-21-23-45(24-22-44)50-51-46-25-27-47(28-26-46)52-53-48-29-31-49(32-30-48)55-36-34-54(35-37-55)33-6-4-2/h13-32,38-39H,3-12,33-37H2,1-2H3/b51-50+,53-52+ |
| InChIKey | HLVWLLVIFDCUKW-AKXDHJQESA-N |
| XLogP | 14.63 |
| TPSA | 55.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.05 |
| LogP ≤ 5 | 14.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|