About benzene;benzenediazonium;yttrium
benzene;benzenediazonium;yttrium (PubChem CID 58862949) has the molecular formula C12H9N2Y-
and a molecular weight of 270.12 g/mol. Its IUPAC name is benzene;benzenediazonium;yttrium.
Molecular Properties
| Compound Name | benzene;benzenediazonium;yttrium |
| PubChem CID | 58862949 |
| Molecular Formula | C12H9N2Y- |
| Molecular Weight | 270.12 g/mol |
| Exact Mass | 269.98 |
| IUPAC Name | benzene;benzenediazonium;yttrium |
| SMILES | N#[N+]c1cc[c-]cc1.[Y].[c-]1ccccc1 |
| InChI | InChI=1S/C6H4N2.C6H5.Y/c7-8-6-4-2-1-3-5-6;1-2-4-6-5-3-1;/h2-5H;1-5H;/q;-1; |
| InChIKey | KXYDZYQGCYRKMB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.12 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze benzene;benzenediazonium;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;benzenediazonium;yttrium?
The IUPAC name of benzene;benzenediazonium;yttrium (CID 58862949) is benzene;benzenediazonium;yttrium.
What is the SMILES notation for benzene;benzenediazonium;yttrium?
The canonical SMILES for benzene;benzenediazonium;yttrium is N#[N+]c1cc[c-]cc1.[Y].[c-]1ccccc1.
What is the InChIKey of benzene;benzenediazonium;yttrium?
The InChIKey is KXYDZYQGCYRKMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2.C6H5.Y/c7-8-6-4-2-1-3-5-6;1-2-4-6-5-3-1;/h2-5H;1-5H;/q;-1;.
What are the key properties of benzene;benzenediazonium;yttrium?
benzene;benzenediazonium;yttrium has a molecular weight of 270.12 g/mol, XLogP of 3.46, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;benzenediazonium;yttrium is sourced from PubChem (CID 58862949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).