About 2-(3-methylbuta-1,3-dien-2-yloxy)ethanol
2-(3-methylbuta-1,3-dien-2-yloxy)ethanol (PubChem CID 58862969) has the molecular formula C7H12O2
and a molecular weight of 128.17 g/mol. Its IUPAC name is 2-(3-methylbuta-1,3-dien-2-yloxy)ethanol.
Molecular Properties
| Compound Name | 2-(3-methylbuta-1,3-dien-2-yloxy)ethanol |
| PubChem CID | 58862969 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | 2-(3-methylbuta-1,3-dien-2-yloxy)ethanol |
| SMILES | C=C(C)C(=C)OCCO |
| InChI | InChI=1S/C7H12O2/c1-6(2)7(3)9-5-4-8/h8H,1,3-5H2,2H3 |
| InChIKey | BQYZDCUKEALQKG-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-methylbuta-1,3-dien-2-yloxy)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methylbuta-1,3-dien-2-yloxy)ethanol?
The IUPAC name of 2-(3-methylbuta-1,3-dien-2-yloxy)ethanol (CID 58862969) is 2-(3-methylbuta-1,3-dien-2-yloxy)ethanol.
What is the SMILES notation for 2-(3-methylbuta-1,3-dien-2-yloxy)ethanol?
The canonical SMILES for 2-(3-methylbuta-1,3-dien-2-yloxy)ethanol is C=C(C)C(=C)OCCO.
What is the InChIKey of 2-(3-methylbuta-1,3-dien-2-yloxy)ethanol?
The InChIKey is BQYZDCUKEALQKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2/c1-6(2)7(3)9-5-4-8/h8H,1,3-5H2,2H3.
What are the key properties of 2-(3-methylbuta-1,3-dien-2-yloxy)ethanol?
2-(3-methylbuta-1,3-dien-2-yloxy)ethanol has a molecular weight of 128.17 g/mol, XLogP of 1.09, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methylbuta-1,3-dien-2-yloxy)ethanol is sourced from PubChem (CID 58862969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).