C25H38O13 — CID 58863066
[(3S,4R,6S)-3-acetyloxy-2-ethyl-5-methyl-6-[(2S,5S)-3,4,5-triacetyloxy-6-ethyloxan-2-yl]oxyoxan-4-yl] acetate (PubChem CID 58863066) has the molecular formula C25H38O13 and a molecular weight of 546.57 g/mol. Its IUPAC name is [(3S,4R,6S)-3-acetyloxy-2-ethyl-5-methyl-6-[(2S,5S)-3,4,5-triacetyloxy-6-ethyloxan-2-yl]oxyoxan-4-yl] acetate.
| Compound Name | [(3S,4R,6S)-3-acetyloxy-2-ethyl-5-methyl-6-[(2S,5S)-3,4,5-triacetyloxy-6-ethyloxan-2-yl]oxyoxan-4-yl] acetate |
|---|---|
| PubChem CID | 58863066 |
| Molecular Formula | C25H38O13 |
| Molecular Weight | 546.57 g/mol |
| Exact Mass | 546.23 |
| IUPAC Name | [(3S,4R,6S)-3-acetyloxy-2-ethyl-5-methyl-6-[(2S,5S)-3,4,5-triacetyloxy-6-ethyloxan-2-yl]oxyoxan-4-yl] acetate |
| SMILES | CCC1O[C@@H](O[C@@H]2OC(CC)[C@H](OC(C)=O)[C@H](OC(C)=O)C2C)C(OC(C)=O)C(OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C25H38O13/c1-9-17-20(32-13(5)27)19(31-12(4)26)11(3)24(36-17)38-25-23(35-16(8)30)22(34-15(7)29)21(33-14(6)28)18(10-2)37-25/h11,17-25H,9-10H2,1-8H3/t11?,17?,18?,19-,20+,21+,22?,23?,24+,25+/m1/s1 |
| InChIKey | WACUAPHHCXDAKW-MFDOJWFKSA-N |
| XLogP | 1.57 |
| TPSA | 159.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.57 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|