C32H20BBr2F2N3 — CID 58863070
6,10-bis(4-bromophenyl)-2,2-difluoro-4,12-diphenyl-3,8-diaza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 58863070) has the molecular formula C32H20BBr2F2N3 and a molecular weight of 655.15 g/mol. Its IUPAC name is 6,10-bis(4-bromophenyl)-2,2-difluoro-4,12-diphenyl-3,8-diaza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 6,10-bis(4-bromophenyl)-2,2-difluoro-4,12-diphenyl-3,8-diaza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 58863070 |
| Molecular Formula | C32H20BBr2F2N3 |
| Molecular Weight | 655.15 g/mol |
| Exact Mass | 653.01 |
| IUPAC Name | 6,10-bis(4-bromophenyl)-2,2-difluoro-4,12-diphenyl-3,8-diaza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | F[B-]1(F)n2c(-c3ccccc3)cc(-c3ccc(Br)cc3)c2N=C2C(c3ccc(Br)cc3)=CC(c3ccccc3)=[N+]21 |
| InChI | InChI=1S/C32H20BBr2F2N3/c34-25-15-11-21(12-16-25)27-19-29(23-7-3-1-4-8-23)39-31(27)38-32-28(22-13-17-26(35)18-14-22)20-30(40(32)33(39,36)37)24-9-5-2-6-10-24/h1-20H |
| InChIKey | UILBYVDBLSOSGC-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 20.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.15 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|