About 5-methyl-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridine
5-methyl-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridine (PubChem CID 58863298) has the molecular formula C7H10N2O
and a molecular weight of 138.17 g/mol. Its IUPAC name is 5-methyl-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridine.
Analyze 5-methyl-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridine?
The IUPAC name of 5-methyl-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridine (CID 58863298) is 5-methyl-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridine.
What is the SMILES notation for 5-methyl-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridine?
The canonical SMILES for 5-methyl-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridine is CN1CCc2oncc2C1.
What is the InChIKey of 5-methyl-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridine?
The InChIKey is GIMKUEPGDPXBNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O/c1-9-3-2-7-6(5-9)4-8-10-7/h4H,2-3,5H2,1H3.
What are the key properties of 5-methyl-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridine?
5-methyl-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridine has a molecular weight of 138.17 g/mol, XLogP of 0.66, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridine is sourced from PubChem (CID 58863298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).