About 3,7-dimethyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-one
3,7-dimethyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-one (PubChem CID 58863315) has the molecular formula C9H13N3O
and a molecular weight of 179.22 g/mol. Its IUPAC name is 3,7-dimethyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 3,7-dimethyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-one |
| PubChem CID | 58863315 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 3,7-dimethyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-one |
| SMILES | CN1CCc2c(ncn(C)c2=O)C1 |
| InChI | InChI=1S/C9H13N3O/c1-11-4-3-7-8(5-11)10-6-12(2)9(7)13/h6H,3-5H2,1-2H3 |
| InChIKey | ZPDASYPLBDQLOJ-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,7-dimethyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dimethyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-one?
The IUPAC name of 3,7-dimethyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-one (CID 58863315) is 3,7-dimethyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-one.
What is the SMILES notation for 3,7-dimethyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-one?
The canonical SMILES for 3,7-dimethyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-one is CN1CCc2c(ncn(C)c2=O)C1.
What is the InChIKey of 3,7-dimethyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-one?
The InChIKey is ZPDASYPLBDQLOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O/c1-11-4-3-7-8(5-11)10-6-12(2)9(7)13/h6H,3-5H2,1-2H3.
What are the key properties of 3,7-dimethyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-one?
3,7-dimethyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-one has a molecular weight of 179.22 g/mol, XLogP of -0.23, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dimethyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-one is sourced from PubChem (CID 58863315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).