About 3-bromo-2,4,5-trimethylthiophene
3-bromo-2,4,5-trimethylthiophene (PubChem CID 58863409) has the molecular formula C7H9BrS
and a molecular weight of 205.12 g/mol. Its IUPAC name is 3-bromo-2,4,5-trimethylthiophene.
Molecular Properties
| Compound Name | 3-bromo-2,4,5-trimethylthiophene |
| PubChem CID | 58863409 |
| Molecular Formula | C7H9BrS |
| Molecular Weight | 205.12 g/mol |
| Exact Mass | 203.96 |
| IUPAC Name | 3-bromo-2,4,5-trimethylthiophene |
| SMILES | Cc1sc(C)c(Br)c1C |
| InChI | InChI=1S/C7H9BrS/c1-4-5(2)9-6(3)7(4)8/h1-3H3 |
| InChIKey | BFJFNKVVMHQWOS-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.12 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-bromo-2,4,5-trimethylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2,4,5-trimethylthiophene?
The IUPAC name of 3-bromo-2,4,5-trimethylthiophene (CID 58863409) is 3-bromo-2,4,5-trimethylthiophene.
What is the SMILES notation for 3-bromo-2,4,5-trimethylthiophene?
The canonical SMILES for 3-bromo-2,4,5-trimethylthiophene is Cc1sc(C)c(Br)c1C.
What is the InChIKey of 3-bromo-2,4,5-trimethylthiophene?
The InChIKey is BFJFNKVVMHQWOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9BrS/c1-4-5(2)9-6(3)7(4)8/h1-3H3.
What are the key properties of 3-bromo-2,4,5-trimethylthiophene?
3-bromo-2,4,5-trimethylthiophene has a molecular weight of 205.12 g/mol, XLogP of 3.44, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2,4,5-trimethylthiophene is sourced from PubChem (CID 58863409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).