About 3-ethyl-3,4-difluorooxolane
3-ethyl-3,4-difluorooxolane (PubChem CID 58864056) has the molecular formula C6H10F2O
and a molecular weight of 136.14 g/mol. Its IUPAC name is 3-ethyl-3,4-difluorooxolane.
Molecular Properties
| Compound Name | 3-ethyl-3,4-difluorooxolane |
| PubChem CID | 58864056 |
| Molecular Formula | C6H10F2O |
| Molecular Weight | 136.14 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | 3-ethyl-3,4-difluorooxolane |
| SMILES | CCC1(F)COCC1F |
| InChI | InChI=1S/C6H10F2O/c1-2-6(8)4-9-3-5(6)7/h5H,2-4H2,1H3 |
| InChIKey | YQMWHBBFAUPEBE-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.14 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethyl-3,4-difluorooxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-3,4-difluorooxolane?
The IUPAC name of 3-ethyl-3,4-difluorooxolane (CID 58864056) is 3-ethyl-3,4-difluorooxolane.
What is the SMILES notation for 3-ethyl-3,4-difluorooxolane?
The canonical SMILES for 3-ethyl-3,4-difluorooxolane is CCC1(F)COCC1F.
What is the InChIKey of 3-ethyl-3,4-difluorooxolane?
The InChIKey is YQMWHBBFAUPEBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10F2O/c1-2-6(8)4-9-3-5(6)7/h5H,2-4H2,1H3.
What are the key properties of 3-ethyl-3,4-difluorooxolane?
3-ethyl-3,4-difluorooxolane has a molecular weight of 136.14 g/mol, XLogP of 1.47, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-3,4-difluorooxolane is sourced from PubChem (CID 58864056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).