C8H3F13O2 — CID 58864059
1,1,1,2,3,3-hexafluoro-3-(1,2,2,2-tetrafluoroethoxy)-2-(1,1,2-trifluoroprop-2-enoxy)propane (PubChem CID 58864059) has the molecular formula C8H3F13O2 and a molecular weight of 378.08 g/mol. Its IUPAC name is 1,1,1,2,3,3-hexafluoro-3-(1,2,2,2-tetrafluoroethoxy)-2-(1,1,2-trifluoroprop-2-enoxy)propane.
| Compound Name | 1,1,1,2,3,3-hexafluoro-3-(1,2,2,2-tetrafluoroethoxy)-2-(1,1,2-trifluoroprop-2-enoxy)propane |
|---|---|
| PubChem CID | 58864059 |
| Molecular Formula | C8H3F13O2 |
| Molecular Weight | 378.08 g/mol |
| Exact Mass | 377.99 |
| IUPAC Name | 1,1,1,2,3,3-hexafluoro-3-(1,2,2,2-tetrafluoroethoxy)-2-(1,1,2-trifluoroprop-2-enoxy)propane |
| SMILES | C=C(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OC(F)C(F)(F)F |
| InChI | InChI=1S/C8H3F13O2/c1-2(9)5(14,15)23-6(16,7(17,18)19)8(20,21)22-3(10)4(11,12)13/h3H,1H2 |
| InChIKey | NQIWSSQOMYQVAK-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.08 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |