C10H16F4O — CID 58864070
3,4,4,4-tetrafluoro-3-(2-methylbutoxymethyl)but-1-ene (PubChem CID 58864070) has the molecular formula C10H16F4O and a molecular weight of 228.23 g/mol. Its IUPAC name is 3,4,4,4-tetrafluoro-3-(2-methylbutoxymethyl)but-1-ene.
| Compound Name | 3,4,4,4-tetrafluoro-3-(2-methylbutoxymethyl)but-1-ene |
|---|---|
| PubChem CID | 58864070 |
| Molecular Formula | C10H16F4O |
| Molecular Weight | 228.23 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 3,4,4,4-tetrafluoro-3-(2-methylbutoxymethyl)but-1-ene |
| SMILES | C=CC(F)(COCC(C)CC)C(F)(F)F |
| InChI | InChI=1S/C10H16F4O/c1-4-8(3)6-15-7-9(11,5-2)10(12,13)14/h5,8H,2,4,6-7H2,1,3H3 |
| InChIKey | GOYSFYXBBQDHJR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.23 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|