C20H25ClN6OS — CID 58864157
4-(2-amino-7-chloroquinolin-4-yl)-N-[(3S)-2-sulfanylideneazepan-3-yl]piperazine-1-carboxamide (PubChem CID 58864157) has the molecular formula C20H25ClN6OS and a molecular weight of 432.98 g/mol. Its IUPAC name is 4-(2-amino-7-chloroquinolin-4-yl)-N-[(3S)-2-sulfanylideneazepan-3-yl]piperazine-1-carboxamide.
| Compound Name | 4-(2-amino-7-chloroquinolin-4-yl)-N-[(3S)-2-sulfanylideneazepan-3-yl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 58864157 |
| Molecular Formula | C20H25ClN6OS |
| Molecular Weight | 432.98 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 4-(2-amino-7-chloroquinolin-4-yl)-N-[(3S)-2-sulfanylideneazepan-3-yl]piperazine-1-carboxamide |
| SMILES | Nc1cc(N2CCN(C(=O)N[C@H]3CCCCNC3=S)CC2)c2ccc(Cl)cc2n1 |
| InChI | InChI=1S/C20H25ClN6OS/c21-13-4-5-14-16(11-13)24-18(22)12-17(14)26-7-9-27(10-8-26)20(28)25-15-3-1-2-6-23-19(15)29/h4-5,11-12,15H,1-3,6-10H2,(H2,22,24)(H,23,29)(H,25,28)/t15-/m0/s1 |
| InChIKey | YIYSBHGPUBCDRR-HNNXBMFYSA-N |
| XLogP | 2.77 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.98 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|