About methyl 2-methyl-6-[[(1R,3S)-3-prop-2-enoxycyclohexyl]oxymethyl]benzoate
methyl 2-methyl-6-[[(1R,3S)-3-prop-2-enoxycyclohexyl]oxymethyl]benzoate (PubChem CID 58864607) has the molecular formula C19H26O4
and a molecular weight of 318.41 g/mol. Its IUPAC name is methyl 2-methyl-6-[[(1R,3S)-3-prop-2-enoxycyclohexyl]oxymethyl]benzoate.
Molecular Properties
| Compound Name | methyl 2-methyl-6-[[(1R,3S)-3-prop-2-enoxycyclohexyl]oxymethyl]benzoate |
| PubChem CID | 58864607 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | methyl 2-methyl-6-[[(1R,3S)-3-prop-2-enoxycyclohexyl]oxymethyl]benzoate |
| SMILES | C=CCO[C@H]1CCC[C@@H](OCc2cccc(C)c2C(=O)OC)C1 |
| InChI | InChI=1S/C19H26O4/c1-4-11-22-16-9-6-10-17(12-16)23-13-15-8-5-7-14(2)18(15)19(20)21-3/h4-5,7-8,16-17H,1,6,9-13H2,2-3H3/t16-,17+/m0/s1 |
| InChIKey | DNKTUBHWUPRMDY-DLBZAZTESA-N |
| XLogP | 3.81 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-methyl-6-[[(1R,3S)-3-prop-2-enoxycyclohexyl]oxymethyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-methyl-6-[[(1R,3S)-3-prop-2-enoxycyclohexyl]oxymethyl]benzoate?
The IUPAC name of methyl 2-methyl-6-[[(1R,3S)-3-prop-2-enoxycyclohexyl]oxymethyl]benzoate (CID 58864607) is methyl 2-methyl-6-[[(1R,3S)-3-prop-2-enoxycyclohexyl]oxymethyl]benzoate.
What is the SMILES notation for methyl 2-methyl-6-[[(1R,3S)-3-prop-2-enoxycyclohexyl]oxymethyl]benzoate?
The canonical SMILES for methyl 2-methyl-6-[[(1R,3S)-3-prop-2-enoxycyclohexyl]oxymethyl]benzoate is C=CCO[C@H]1CCC[C@@H](OCc2cccc(C)c2C(=O)OC)C1.
What is the InChIKey of methyl 2-methyl-6-[[(1R,3S)-3-prop-2-enoxycyclohexyl]oxymethyl]benzoate?
The InChIKey is DNKTUBHWUPRMDY-DLBZAZTESA-N. The full InChI is InChI=1S/C19H26O4/c1-4-11-22-16-9-6-10-17(12-16)23-13-15-8-5-7-14(2)18(15)19(20)21-3/h4-5,7-8,16-17H,1,6,9-13H2,2-3H3/t16-,17+/m0/s1.
What are the key properties of methyl 2-methyl-6-[[(1R,3S)-3-prop-2-enoxycyclohexyl]oxymethyl]benzoate?
methyl 2-methyl-6-[[(1R,3S)-3-prop-2-enoxycyclohexyl]oxymethyl]benzoate has a molecular weight of 318.41 g/mol, XLogP of 3.81, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methyl-6-[[(1R,3S)-3-prop-2-enoxycyclohexyl]oxymethyl]benzoate is sourced from PubChem (CID 58864607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).